About 6-ethenyl-2,2,6-trimethyloxan-3-one
6-ethenyl-2,2,6-trimethyloxan-3-one (PubChem CID 549336) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 6-ethenyl-2,2,6-trimethyloxan-3-one.
Molecular Properties
| Compound Name | 6-ethenyl-2,2,6-trimethyloxan-3-one |
| PubChem CID | 549336 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 6-ethenyl-2,2,6-trimethyloxan-3-one |
| SMILES | C=CC1(C)CCC(=O)C(C)(C)O1 |
| InChI | InChI=1S/C10H16O2/c1-5-10(4)7-6-8(11)9(2,3)12-10/h5H,1,6-7H2,2-4H3 |
| InChIKey | ATQPZCOAQSYTPR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenyl-2,2,6-trimethyloxan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-2,2,6-trimethyloxan-3-one?
The IUPAC name of 6-ethenyl-2,2,6-trimethyloxan-3-one (CID 549336) is 6-ethenyl-2,2,6-trimethyloxan-3-one.
What is the SMILES notation for 6-ethenyl-2,2,6-trimethyloxan-3-one?
The canonical SMILES for 6-ethenyl-2,2,6-trimethyloxan-3-one is C=CC1(C)CCC(=O)C(C)(C)O1.
What is the InChIKey of 6-ethenyl-2,2,6-trimethyloxan-3-one?
The InChIKey is ATQPZCOAQSYTPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-5-10(4)7-6-8(11)9(2,3)12-10/h5H,1,6-7H2,2-4H3.
What are the key properties of 6-ethenyl-2,2,6-trimethyloxan-3-one?
6-ethenyl-2,2,6-trimethyloxan-3-one has a molecular weight of 168.24 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-2,2,6-trimethyloxan-3-one is sourced from PubChem (CID 549336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).