C11H19N3O4S — CID 54933933
5-(heptan-2-ylsulfamoyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 54933933) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is 5-(heptan-2-ylsulfamoyl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(heptan-2-ylsulfamoyl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 54933933 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-(heptan-2-ylsulfamoyl)-1H-pyrazole-4-carboxylic acid |
| SMILES | CCCCCC(C)NS(=O)(=O)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C11H19N3O4S/c1-3-4-5-6-8(2)14-19(17,18)10-9(11(15)16)7-12-13-10/h7-8,14H,3-6H2,1-2H3,(H,12,13)(H,15,16) |
| InChIKey | PJZQHDAYMKFQCC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|