C11H16N2O3S — CID 54935124
2-(2-methylsulfonylethylamino)-N-phenylacetamide (PubChem CID 54935124) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(2-methylsulfonylethylamino)-N-phenylacetamide.
| Compound Name | 2-(2-methylsulfonylethylamino)-N-phenylacetamide |
|---|---|
| PubChem CID | 54935124 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-(2-methylsulfonylethylamino)-N-phenylacetamide |
| SMILES | CS(=O)(=O)CCNCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H16N2O3S/c1-17(15,16)8-7-12-9-11(14)13-10-5-3-2-4-6-10/h2-6,12H,7-9H2,1H3,(H,13,14) |
| InChIKey | XAPQDKGBLOYPQG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|