About 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one
1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one (PubChem CID 549352) has the molecular formula C17H21NO
and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one.
Molecular Properties
| Compound Name | 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one |
| PubChem CID | 549352 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one |
| SMILES | C=C(C)C1CCC(C(=C)C)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H21NO/c1-12(2)15-10-11-16(13(3)4)18(17(15)19)14-8-6-5-7-9-14/h5-9,15-16H,1,3,10-11H2,2,4H3 |
| InChIKey | HERFHCQHRFIIGT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one?
The IUPAC name of 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one (CID 549352) is 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one.
What is the SMILES notation for 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one?
The canonical SMILES for 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one is C=C(C)C1CCC(C(=C)C)N(c2ccccc2)C1=O.
What is the InChIKey of 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one?
The InChIKey is HERFHCQHRFIIGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO/c1-12(2)15-10-11-16(13(3)4)18(17(15)19)14-8-6-5-7-9-14/h5-9,15-16H,1,3,10-11H2,2,4H3.
What are the key properties of 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one?
1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one has a molecular weight of 255.36 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3,6-bis(prop-1-en-2-yl)piperidin-2-one is sourced from PubChem (CID 549352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).