About 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine
3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine (PubChem CID 54935596) has the molecular formula C14H31N3O
and a molecular weight of 257.42 g/mol. Its IUPAC name is 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine |
| PubChem CID | 54935596 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine |
| SMILES | CCC(CCN)N1CCCN(CCCOC)CC1 |
| InChI | InChI=1S/C14H31N3O/c1-3-14(6-7-15)17-10-4-8-16(11-12-17)9-5-13-18-2/h14H,3-13,15H2,1-2H3 |
| InChIKey | SKQLEZZQVVSWLE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine?
The IUPAC name of 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine (CID 54935596) is 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine.
What is the SMILES notation for 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine?
The canonical SMILES for 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine is CCC(CCN)N1CCCN(CCCOC)CC1.
What is the InChIKey of 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine?
The InChIKey is SKQLEZZQVVSWLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N3O/c1-3-14(6-7-15)17-10-4-8-16(11-12-17)9-5-13-18-2/h14H,3-13,15H2,1-2H3.
What are the key properties of 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine?
3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine has a molecular weight of 257.42 g/mol, XLogP of 1.16, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-methoxypropyl)-1,4-diazepan-1-yl]pentan-1-amine is sourced from PubChem (CID 54935596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).