About 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide
3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide (PubChem CID 54935862) has the molecular formula C15H26N2OS
and a molecular weight of 282.45 g/mol. Its IUPAC name is 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide |
| PubChem CID | 54935862 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNC(C)c1cc(C)sc1C |
| InChI | InChI=1S/C15H26N2OS/c1-6-17(7-2)15(18)8-9-16-12(4)14-10-11(3)19-13(14)5/h10,12,16H,6-9H2,1-5H3 |
| InChIKey | RDMFEMRYSXJFDC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide?
The IUPAC name of 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide (CID 54935862) is 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide.
What is the SMILES notation for 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide?
The canonical SMILES for 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide is CCN(CC)C(=O)CCNC(C)c1cc(C)sc1C.
What is the InChIKey of 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide?
The InChIKey is RDMFEMRYSXJFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2OS/c1-6-17(7-2)15(18)8-9-16-12(4)14-10-11(3)19-13(14)5/h10,12,16H,6-9H2,1-5H3.
What are the key properties of 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide?
3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide has a molecular weight of 282.45 g/mol, XLogP of 3.27, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-N,N-diethylpropanamide is sourced from PubChem (CID 54935862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).