C17H18N2 — CID 54936274
3-[[(3,4-dimethylphenyl)methylamino]methyl]benzonitrile (PubChem CID 54936274) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-[[(3,4-dimethylphenyl)methylamino]methyl]benzonitrile.
| Compound Name | 3-[[(3,4-dimethylphenyl)methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 54936274 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-[[(3,4-dimethylphenyl)methylamino]methyl]benzonitrile |
| SMILES | Cc1ccc(CNCc2cccc(C#N)c2)cc1C |
| InChI | InChI=1S/C17H18N2/c1-13-6-7-17(8-14(13)2)12-19-11-16-5-3-4-15(9-16)10-18/h3-9,19H,11-12H2,1-2H3 |
| InChIKey | KTFMXHGFASIEHC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |