About 1,2-dipentylcyclopropene
1,2-dipentylcyclopropene (PubChem CID 549365) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is 1,2-dipentylcyclopropene.
Molecular Properties
| Compound Name | 1,2-dipentylcyclopropene |
| PubChem CID | 549365 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1,2-dipentylcyclopropene |
| SMILES | CCCCCC1=C(CCCCC)C1 |
| InChI | InChI=1S/C13H24/c1-3-5-7-9-12-11-13(12)10-8-6-4-2/h3-11H2,1-2H3 |
| InChIKey | XCRVVVWLTPRNIX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dipentylcyclopropene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dipentylcyclopropene?
The IUPAC name of 1,2-dipentylcyclopropene (CID 549365) is 1,2-dipentylcyclopropene.
What is the SMILES notation for 1,2-dipentylcyclopropene?
The canonical SMILES for 1,2-dipentylcyclopropene is CCCCCC1=C(CCCCC)C1.
What is the InChIKey of 1,2-dipentylcyclopropene?
The InChIKey is XCRVVVWLTPRNIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-3-5-7-9-12-11-13(12)10-8-6-4-2/h3-11H2,1-2H3.
What are the key properties of 1,2-dipentylcyclopropene?
1,2-dipentylcyclopropene has a molecular weight of 180.33 g/mol, XLogP of 4.85, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dipentylcyclopropene is sourced from PubChem (CID 549365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).