About 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride
4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride (PubChem CID 54939277) has the molecular formula C9H8ClF2NO5S
and a molecular weight of 315.68 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride |
| PubChem CID | 54939277 |
| Molecular Formula | C9H8ClF2NO5S |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride |
| SMILES | Cc1cc(OCC(F)F)c([N+](=O)[O-])cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H8ClF2NO5S/c1-5-2-7(18-4-9(11)12)6(13(14)15)3-8(5)19(10,16)17/h2-3,9H,4H2,1H3 |
| InChIKey | MKIOYJRKOHOOIF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride?
The IUPAC name of 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride (CID 54939277) is 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride.
What is the SMILES notation for 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride?
The canonical SMILES for 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride is Cc1cc(OCC(F)F)c([N+](=O)[O-])cc1S(=O)(=O)Cl.
What is the InChIKey of 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride?
The InChIKey is MKIOYJRKOHOOIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF2NO5S/c1-5-2-7(18-4-9(11)12)6(13(14)15)3-8(5)19(10,16)17/h2-3,9H,4H2,1H3.
What are the key properties of 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride?
4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride has a molecular weight of 315.68 g/mol, XLogP of 2.47, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethoxy)-2-methyl-5-nitrobenzenesulfonyl chloride is sourced from PubChem (CID 54939277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).