C23H30N2O — CID 549396
(4b,8-dimethyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl)-(1H-imidazol-2-yl)methanone (PubChem CID 549396) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (4b,8-dimethyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl)-(1H-imidazol-2-yl)methanone.
| Compound Name | (4b,8-dimethyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl)-(1H-imidazol-2-yl)methanone |
|---|---|
| PubChem CID | 549396 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (4b,8-dimethyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl)-(1H-imidazol-2-yl)methanone |
| SMILES | CC(C)c1ccc2c(c1)CC(C(=O)c1ncc[nH]1)C1C(C)CCCC21C |
| InChI | InChI=1S/C23H30N2O/c1-14(2)16-7-8-19-17(12-16)13-18(21(26)22-24-10-11-25-22)20-15(3)6-5-9-23(19,20)4/h7-8,10-12,14-15,18,20H,5-6,9,13H2,1-4H3,(H,24,25) |
| InChIKey | ZSKHEXHRJOMZQW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |