C15H22BrNO — CID 54942465
N-[(3-bromophenyl)methyl]-1-cyclopropyl-N-(2-methoxyethyl)ethanamine (PubChem CID 54942465) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-1-cyclopropyl-N-(2-methoxyethyl)ethanamine.
| Compound Name | N-[(3-bromophenyl)methyl]-1-cyclopropyl-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 54942465 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-1-cyclopropyl-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCN(Cc1cccc(Br)c1)C(C)C1CC1 |
| InChI | InChI=1S/C15H22BrNO/c1-12(14-6-7-14)17(8-9-18-2)11-13-4-3-5-15(16)10-13/h3-5,10,12,14H,6-9,11H2,1-2H3 |
| InChIKey | WPAXALXUPREIPO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |