C12H15N3O2 — CID 54942473
3-[ethyl-[(2-nitrophenyl)methyl]amino]propanenitrile (PubChem CID 54942473) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-[ethyl-[(2-nitrophenyl)methyl]amino]propanenitrile.
| Compound Name | 3-[ethyl-[(2-nitrophenyl)methyl]amino]propanenitrile |
|---|---|
| PubChem CID | 54942473 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-[ethyl-[(2-nitrophenyl)methyl]amino]propanenitrile |
| SMILES | CCN(CCC#N)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O2/c1-2-14(9-5-8-13)10-11-6-3-4-7-12(11)15(16)17/h3-4,6-7H,2,5,9-10H2,1H3 |
| InChIKey | XEZJUBIWUORMTI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|