About (2S)-2-aminohexan-1-ol
(2S)-2-aminohexan-1-ol (PubChem CID 5494388) has the molecular formula C6H15NO
and a molecular weight of 117.19 g/mol. Its IUPAC name is (2S)-2-aminohexan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-aminohexan-1-ol |
| PubChem CID | 5494388 |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.12 |
| IUPAC Name | (2S)-2-aminohexan-1-ol |
| SMILES | CCCC[C@H](N)CO |
| InChI | InChI=1S/C6H15NO/c1-2-3-4-6(7)5-8/h6,8H,2-5,7H2,1H3/t6-/m0/s1 |
| InChIKey | DPEOTCPCYHSVTC-LURJTMIESA-N |
| XLogP | 0.50 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-aminohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminohexan-1-ol?
The IUPAC name of (2S)-2-aminohexan-1-ol (CID 5494388) is (2S)-2-aminohexan-1-ol.
What is the SMILES notation for (2S)-2-aminohexan-1-ol?
The canonical SMILES for (2S)-2-aminohexan-1-ol is CCCC[C@H](N)CO.
What is the InChIKey of (2S)-2-aminohexan-1-ol?
The InChIKey is DPEOTCPCYHSVTC-LURJTMIESA-N. The full InChI is InChI=1S/C6H15NO/c1-2-3-4-6(7)5-8/h6,8H,2-5,7H2,1H3/t6-/m0/s1.
What are the key properties of (2S)-2-aminohexan-1-ol?
(2S)-2-aminohexan-1-ol has a molecular weight of 117.19 g/mol, XLogP of 0.50, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminohexan-1-ol is sourced from PubChem (CID 5494388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).