About 4-methylcyclohex-4-ene-1,2-dicarbonitrile
4-methylcyclohex-4-ene-1,2-dicarbonitrile (PubChem CID 549439) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 4-methylcyclohex-4-ene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-methylcyclohex-4-ene-1,2-dicarbonitrile |
| PubChem CID | 549439 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 4-methylcyclohex-4-ene-1,2-dicarbonitrile |
| SMILES | CC1=CCC(C#N)C(C#N)C1 |
| InChI | InChI=1S/C9H10N2/c1-7-2-3-8(5-10)9(4-7)6-11/h2,8-9H,3-4H2,1H3 |
| InChIKey | BVWBKVGFSXXJJW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylcyclohex-4-ene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclohex-4-ene-1,2-dicarbonitrile?
The IUPAC name of 4-methylcyclohex-4-ene-1,2-dicarbonitrile (CID 549439) is 4-methylcyclohex-4-ene-1,2-dicarbonitrile.
What is the SMILES notation for 4-methylcyclohex-4-ene-1,2-dicarbonitrile?
The canonical SMILES for 4-methylcyclohex-4-ene-1,2-dicarbonitrile is CC1=CCC(C#N)C(C#N)C1.
What is the InChIKey of 4-methylcyclohex-4-ene-1,2-dicarbonitrile?
The InChIKey is BVWBKVGFSXXJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-2-3-8(5-10)9(4-7)6-11/h2,8-9H,3-4H2,1H3.
What are the key properties of 4-methylcyclohex-4-ene-1,2-dicarbonitrile?
4-methylcyclohex-4-ene-1,2-dicarbonitrile has a molecular weight of 146.19 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohex-4-ene-1,2-dicarbonitrile is sourced from PubChem (CID 549439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).