C11H14ClN3O2 — CID 54944221
2-chloro-N-(2-pyridin-4-ylethylcarbamoyl)propanamide (PubChem CID 54944221) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.71 g/mol. Its IUPAC name is 2-chloro-N-(2-pyridin-4-ylethylcarbamoyl)propanamide.
| Compound Name | 2-chloro-N-(2-pyridin-4-ylethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 54944221 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-chloro-N-(2-pyridin-4-ylethylcarbamoyl)propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)NCCc1ccncc1 |
| InChI | InChI=1S/C11H14ClN3O2/c1-8(12)10(16)15-11(17)14-7-4-9-2-5-13-6-3-9/h2-3,5-6,8H,4,7H2,1H3,(H2,14,15,16,17) |
| InChIKey | NJHORGJSADHZPU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|