About 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide
3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide (PubChem CID 54945365) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide.
Molecular Properties
| Compound Name | 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide |
| PubChem CID | 54945365 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)n1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C13H18N4/c1-8-4-11-12(5-9(8)2)17(7-16-11)10(3)6-13(14)15/h4-5,7,10H,6H2,1-3H3,(H3,14,15) |
| InChIKey | HCFJYSHMOWXWEK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide?
The IUPAC name of 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide (CID 54945365) is 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide.
What is the SMILES notation for 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide?
The canonical SMILES for 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide is [H]/N=C(\N)CC(C)n1cnc2cc(C)c(C)cc21.
What is the InChIKey of 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide?
The InChIKey is HCFJYSHMOWXWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4/c1-8-4-11-12(5-9(8)2)17(7-16-11)10(3)6-13(14)15/h4-5,7,10H,6H2,1-3H3,(H3,14,15).
What are the key properties of 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide?
3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide has a molecular weight of 230.31 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dimethylbenzimidazol-1-yl)butanimidamide is sourced from PubChem (CID 54945365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).