C14H25N3O — CID 54946712
2-[(2-cyanocyclohexyl)-methylamino]-N,N-diethylacetamide (PubChem CID 54946712) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-[(2-cyanocyclohexyl)-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(2-cyanocyclohexyl)-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 54946712 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-[(2-cyanocyclohexyl)-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)C1CCCCC1C#N |
| InChI | InChI=1S/C14H25N3O/c1-4-17(5-2)14(18)11-16(3)13-9-7-6-8-12(13)10-15/h12-13H,4-9,11H2,1-3H3 |
| InChIKey | UPAYNDVGGMTMOX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |