About 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid (PubChem CID 54947233) has the molecular formula C10H16N2O5S
and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid.
Molecular Properties
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid |
| PubChem CID | 54947233 |
| Molecular Formula | C10H16N2O5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid |
| SMILES | Cc1noc(C)c1CN(C)S(=O)(=O)C(C)C(=O)O |
| InChI | InChI=1S/C10H16N2O5S/c1-6-9(7(2)17-11-6)5-12(4)18(15,16)8(3)10(13)14/h8H,5H2,1-4H3,(H,13,14) |
| InChIKey | WBHJAWWKWXUEME-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid?
The IUPAC name of 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid (CID 54947233) is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid.
What is the SMILES notation for 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid?
The canonical SMILES for 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid is Cc1noc(C)c1CN(C)S(=O)(=O)C(C)C(=O)O.
What is the InChIKey of 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid?
The InChIKey is WBHJAWWKWXUEME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O5S/c1-6-9(7(2)17-11-6)5-12(4)18(15,16)8(3)10(13)14/h8H,5H2,1-4H3,(H,13,14).
What are the key properties of 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid?
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid has a molecular weight of 276.31 g/mol, XLogP of 0.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylsulfamoyl]propanoic acid is sourced from PubChem (CID 54947233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).