About 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide
1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide (PubChem CID 54947526) has the molecular formula C11H23NO4S
and a molecular weight of 265.37 g/mol. Its IUPAC name is 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide |
| PubChem CID | 54947526 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide |
| SMILES | O=S(=O)(CC1CCCCC1)N(CCO)CCO |
| InChI | InChI=1S/C11H23NO4S/c13-8-6-12(7-9-14)17(15,16)10-11-4-2-1-3-5-11/h11,13-14H,1-10H2 |
| InChIKey | AJNCGFSIMZIKBY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide?
The IUPAC name of 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide (CID 54947526) is 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide.
What is the SMILES notation for 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide?
The canonical SMILES for 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide is O=S(=O)(CC1CCCCC1)N(CCO)CCO.
What is the InChIKey of 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide?
The InChIKey is AJNCGFSIMZIKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO4S/c13-8-6-12(7-9-14)17(15,16)10-11-4-2-1-3-5-11/h11,13-14H,1-10H2.
What are the key properties of 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide?
1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide has a molecular weight of 265.37 g/mol, XLogP of 0.18, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N,N-bis(2-hydroxyethyl)methanesulfonamide is sourced from PubChem (CID 54947526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).