About 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide
1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide (PubChem CID 54947631) has the molecular formula C10H18N4O2S
and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide |
| PubChem CID | 54947631 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide |
| SMILES | O=S(=O)(CC1CCCCC1)NCc1ncn[nH]1 |
| InChI | InChI=1S/C10H18N4O2S/c15-17(16,7-9-4-2-1-3-5-9)13-6-10-11-8-12-14-10/h8-9,13H,1-7H2,(H,11,12,14) |
| InChIKey | HWOYDKSCPFEUTE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide?
The IUPAC name of 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide (CID 54947631) is 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide.
What is the SMILES notation for 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide?
The canonical SMILES for 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide is O=S(=O)(CC1CCCCC1)NCc1ncn[nH]1.
What is the InChIKey of 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide?
The InChIKey is HWOYDKSCPFEUTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2S/c15-17(16,7-9-4-2-1-3-5-9)13-6-10-11-8-12-14-10/h8-9,13H,1-7H2,(H,11,12,14).
What are the key properties of 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide?
1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide has a molecular weight of 258.35 g/mol, XLogP of 0.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)methanesulfonamide is sourced from PubChem (CID 54947631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).