C11H19N3O2S — CID 54947671
3-N-methyl-3-N-[methyl(propan-2-yl)sulfamoyl]benzene-1,3-diamine (PubChem CID 54947671) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-N-methyl-3-N-[methyl(propan-2-yl)sulfamoyl]benzene-1,3-diamine.
| Compound Name | 3-N-methyl-3-N-[methyl(propan-2-yl)sulfamoyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 54947671 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-N-methyl-3-N-[methyl(propan-2-yl)sulfamoyl]benzene-1,3-diamine |
| SMILES | CC(C)N(C)S(=O)(=O)N(C)c1cccc(N)c1 |
| InChI | InChI=1S/C11H19N3O2S/c1-9(2)13(3)17(15,16)14(4)11-7-5-6-10(12)8-11/h5-9H,12H2,1-4H3 |
| InChIKey | BBESPGAGRCVINT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|