C14H25N3 — CID 54948170
1-N-ethyl-1-N-(pyridin-4-ylmethyl)hexane-1,2-diamine (PubChem CID 54948170) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is 1-N-ethyl-1-N-(pyridin-4-ylmethyl)hexane-1,2-diamine.
| Compound Name | 1-N-ethyl-1-N-(pyridin-4-ylmethyl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 54948170 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 1-N-ethyl-1-N-(pyridin-4-ylmethyl)hexane-1,2-diamine |
| SMILES | CCCCC(N)CN(CC)Cc1ccncc1 |
| InChI | InChI=1S/C14H25N3/c1-3-5-6-14(15)12-17(4-2)11-13-7-9-16-10-8-13/h7-10,14H,3-6,11-12,15H2,1-2H3 |
| InChIKey | WYLLVACYVOZFEY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |