About 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one
1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one (PubChem CID 5494827) has the molecular formula C16H15NO5
and a molecular weight of 301.30 g/mol. Its IUPAC name is 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one.
Molecular Properties
| Compound Name | 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one |
| PubChem CID | 5494827 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one |
| SMILES | COc1cc(O)c2c(=O)c3ccc(O)c(OC)c3n(C)c2c1 |
| InChI | InChI=1S/C16H15NO5/c1-17-10-6-8(21-2)7-12(19)13(10)15(20)9-4-5-11(18)16(22-3)14(9)17/h4-7,18-19H,1-3H3 |
| InChIKey | OQMSMWRXIZYYNR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one?
The IUPAC name of 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one (CID 5494827) is 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one.
What is the SMILES notation for 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one?
The canonical SMILES for 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one is COc1cc(O)c2c(=O)c3ccc(O)c(OC)c3n(C)c2c1.
What is the InChIKey of 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one?
The InChIKey is OQMSMWRXIZYYNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO5/c1-17-10-6-8(21-2)7-12(19)13(10)15(20)9-4-5-11(18)16(22-3)14(9)17/h4-7,18-19H,1-3H3.
What are the key properties of 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one?
1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one has a molecular weight of 301.30 g/mol, XLogP of 2.12, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one is sourced from PubChem (CID 5494827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).