C20H28N2O2 — CID 5494859
(2R,3R)-1,4-bis[[(1S)-1-phenylethyl]amino]butane-2,3-diol (PubChem CID 5494859) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (2R,3R)-1,4-bis[[(1S)-1-phenylethyl]amino]butane-2,3-diol.
| Compound Name | (2R,3R)-1,4-bis[[(1S)-1-phenylethyl]amino]butane-2,3-diol |
|---|---|
| PubChem CID | 5494859 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (2R,3R)-1,4-bis[[(1S)-1-phenylethyl]amino]butane-2,3-diol |
| SMILES | C[C@H](NC[C@@H](O)[C@H](O)CN[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28N2O2/c1-15(17-9-5-3-6-10-17)21-13-19(23)20(24)14-22-16(2)18-11-7-4-8-12-18/h3-12,15-16,19-24H,13-14H2,1-2H3/t15-,16-,19+,20+/m0/s1 |
| InChIKey | YYRPYLTZDMTOFU-XAMWDVODSA-N |
| XLogP | 2.41 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |