C13H22N3O+ — CID 54948829
N-(cyclohexylmethyl)-N,3-dimethylimidazol-3-ium-1-carboxamide (PubChem CID 54948829) has the molecular formula C13H22N3O+ and a molecular weight of 236.34 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N,3-dimethylimidazol-3-ium-1-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-N,3-dimethylimidazol-3-ium-1-carboxamide |
|---|---|
| PubChem CID | 54948829 |
| Molecular Formula | C13H22N3O+ |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | N-(cyclohexylmethyl)-N,3-dimethylimidazol-3-ium-1-carboxamide |
| SMILES | CN(CC1CCCCC1)C(=O)n1cc[n+](C)c1 |
| InChI | InChI=1S/C13H22N3O/c1-14-8-9-16(11-14)13(17)15(2)10-12-6-4-3-5-7-12/h8-9,11-12H,3-7,10H2,1-2H3/q+1 |
| InChIKey | QKMACTFPQYRLRV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|