C10H19NO6S — CID 54951313
3-[(1-methoxy-1-oxopropan-2-yl)sulfonyl-propan-2-ylamino]propanoic acid (PubChem CID 54951313) has the molecular formula C10H19NO6S and a molecular weight of 281.33 g/mol. Its IUPAC name is 3-[(1-methoxy-1-oxopropan-2-yl)sulfonyl-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[(1-methoxy-1-oxopropan-2-yl)sulfonyl-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 54951313 |
| Molecular Formula | C10H19NO6S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-[(1-methoxy-1-oxopropan-2-yl)sulfonyl-propan-2-ylamino]propanoic acid |
| SMILES | COC(=O)C(C)S(=O)(=O)N(CCC(=O)O)C(C)C |
| InChI | InChI=1S/C10H19NO6S/c1-7(2)11(6-5-9(12)13)18(15,16)8(3)10(14)17-4/h7-8H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | LYFSSRVWKWFRAQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |