C10H15BrN2O2S2 — CID 54952440
3-bromo-N-methyl-N-piperidin-4-ylthiophene-2-sulfonamide (PubChem CID 54952440) has the molecular formula C10H15BrN2O2S2 and a molecular weight of 339.28 g/mol. Its IUPAC name is 3-bromo-N-methyl-N-piperidin-4-ylthiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-methyl-N-piperidin-4-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54952440 |
| Molecular Formula | C10H15BrN2O2S2 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 3-bromo-N-methyl-N-piperidin-4-ylthiophene-2-sulfonamide |
| SMILES | CN(C1CCNCC1)S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C10H15BrN2O2S2/c1-13(8-2-5-12-6-3-8)17(14,15)10-9(11)4-7-16-10/h4,7-8,12H,2-3,5-6H2,1H3 |
| InChIKey | JUGVLWJSBFEHRZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |