About 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid
6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid (PubChem CID 54953806) has the molecular formula C11H12N4O2S
and a molecular weight of 264.31 g/mol. Its IUPAC name is 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid |
| PubChem CID | 54953806 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid |
| SMILES | CCc1nc(Nc2ccc(C(=O)O)nn2)sc1C |
| InChI | InChI=1S/C11H12N4O2S/c1-3-7-6(2)18-11(12-7)13-9-5-4-8(10(16)17)14-15-9/h4-5H,3H2,1-2H3,(H,16,17)(H,12,13,15) |
| InChIKey | QTVBDWVUJMMFMY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid?
The IUPAC name of 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid (CID 54953806) is 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid.
What is the SMILES notation for 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid?
The canonical SMILES for 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid is CCc1nc(Nc2ccc(C(=O)O)nn2)sc1C.
What is the InChIKey of 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid?
The InChIKey is QTVBDWVUJMMFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2S/c1-3-7-6(2)18-11(12-7)13-9-5-4-8(10(16)17)14-15-9/h4-5H,3H2,1-2H3,(H,16,17)(H,12,13,15).
What are the key properties of 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid?
6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid has a molecular weight of 264.31 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]pyridazine-3-carboxylic acid is sourced from PubChem (CID 54953806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).