C12H21N3O2S — CID 54953828
1-N,1-N,3-trimethyl-2-N-[(5-nitrothiophen-3-yl)methyl]butane-1,2-diamine (PubChem CID 54953828) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-N,1-N,3-trimethyl-2-N-[(5-nitrothiophen-3-yl)methyl]butane-1,2-diamine.
| Compound Name | 1-N,1-N,3-trimethyl-2-N-[(5-nitrothiophen-3-yl)methyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 54953828 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-N,1-N,3-trimethyl-2-N-[(5-nitrothiophen-3-yl)methyl]butane-1,2-diamine |
| SMILES | CC(C)C(CN(C)C)NCc1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H21N3O2S/c1-9(2)11(7-14(3)4)13-6-10-5-12(15(16)17)18-8-10/h5,8-9,11,13H,6-7H2,1-4H3 |
| InChIKey | KTIUGBQUSJRUFT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|