About N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide
N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 54953916) has the molecular formula C10H14N4O2S2
and a molecular weight of 286.38 g/mol. Its IUPAC name is N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide |
| PubChem CID | 54953916 |
| Molecular Formula | C10H14N4O2S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CCc1nc(NS(=O)(=O)c2cn[nH]c2C)sc1C |
| InChI | InChI=1S/C10H14N4O2S2/c1-4-8-7(3)17-10(12-8)14-18(15,16)9-5-11-13-6(9)2/h5H,4H2,1-3H3,(H,11,13)(H,12,14) |
| InChIKey | HXFGQNSSFXXNSV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide (CID 54953916) is N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide is CCc1nc(NS(=O)(=O)c2cn[nH]c2C)sc1C.
What is the InChIKey of N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide?
The InChIKey is HXFGQNSSFXXNSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O2S2/c1-4-8-7(3)17-10(12-8)14-18(15,16)9-5-11-13-6(9)2/h5H,4H2,1-3H3,(H,11,13)(H,12,14).
What are the key properties of N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide?
N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide has a molecular weight of 286.38 g/mol, XLogP of 1.85, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-5-methyl-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 54953916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).