C11H13ClN2O2S — CID 54955058
3-[1-(5-chlorothiophen-2-yl)ethylamino]-1-methylpyrrolidine-2,5-dione (PubChem CID 54955058) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 3-[1-(5-chlorothiophen-2-yl)ethylamino]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[1-(5-chlorothiophen-2-yl)ethylamino]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54955058 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3-[1-(5-chlorothiophen-2-yl)ethylamino]-1-methylpyrrolidine-2,5-dione |
| SMILES | CC(NC1CC(=O)N(C)C1=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H13ClN2O2S/c1-6(8-3-4-9(12)17-8)13-7-5-10(15)14(2)11(7)16/h3-4,6-7,13H,5H2,1-2H3 |
| InChIKey | DTAAYFCRXFCKJT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|