C15H12N2O3 — CID 5495598
4,10-dimethyl-2-oxo-1H-1,7-phenanthroline-9-carboxylic acid (PubChem CID 5495598) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 4,10-dimethyl-2-oxo-1H-1,7-phenanthroline-9-carboxylic acid.
| Compound Name | 4,10-dimethyl-2-oxo-1H-1,7-phenanthroline-9-carboxylic acid |
|---|---|
| PubChem CID | 5495598 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4,10-dimethyl-2-oxo-1H-1,7-phenanthroline-9-carboxylic acid |
| SMILES | Cc1cc(=O)[nH]c2c1ccc1ncc(C(=O)O)c(C)c12 |
| InChI | InChI=1S/C15H12N2O3/c1-7-5-12(18)17-14-9(7)3-4-11-13(14)8(2)10(6-16-11)15(19)20/h3-6H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | CLBNKDVBVZWNEN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|