C13H15NO2S — CID 54956266
2-[(2-propan-2-yl-1,3-thiazol-4-yl)methoxy]phenol (PubChem CID 54956266) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-[(2-propan-2-yl-1,3-thiazol-4-yl)methoxy]phenol.
| Compound Name | 2-[(2-propan-2-yl-1,3-thiazol-4-yl)methoxy]phenol |
|---|---|
| PubChem CID | 54956266 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-[(2-propan-2-yl-1,3-thiazol-4-yl)methoxy]phenol |
| SMILES | CC(C)c1nc(COc2ccccc2O)cs1 |
| InChI | InChI=1S/C13H15NO2S/c1-9(2)13-14-10(8-17-13)7-16-12-6-4-3-5-11(12)15/h3-6,8-9,15H,7H2,1-2H3 |
| InChIKey | CDJYURVUILBUAA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |