About 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide
2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide (PubChem CID 54957248) has the molecular formula C11H22N2O4
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide.
Molecular Properties
| Compound Name | 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide |
| PubChem CID | 54957248 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CNCC1COCCO1 |
| InChI | InChI=1S/C11H22N2O4/c1-15-4-2-3-13-11(14)8-12-7-10-9-16-5-6-17-10/h10,12H,2-9H2,1H3,(H,13,14) |
| InChIKey | APAJHWJHBNHNAL-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide?
The IUPAC name of 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide (CID 54957248) is 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide.
What is the SMILES notation for 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide?
The canonical SMILES for 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide is COCCCNC(=O)CNCC1COCCO1.
What is the InChIKey of 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide?
The InChIKey is APAJHWJHBNHNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4/c1-15-4-2-3-13-11(14)8-12-7-10-9-16-5-6-17-10/h10,12H,2-9H2,1H3,(H,13,14).
What are the key properties of 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide?
2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide has a molecular weight of 246.31 g/mol, XLogP of -0.86, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxan-2-ylmethylamino)-N-(3-methoxypropyl)acetamide is sourced from PubChem (CID 54957248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).