About 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid
2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid (PubChem CID 54957939) has the molecular formula C12H22O4S
and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid |
| PubChem CID | 54957939 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CCC(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22O4S/c1-12(2,3)6-4-10(11(13)14)9-5-7-17(15,16)8-9/h9-10H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | SYOBJCKCRUVXOR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid (CID 54957939) is 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid is CC(C)(C)CCC(C(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid?
The InChIKey is SYOBJCKCRUVXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4S/c1-12(2,3)6-4-10(11(13)14)9-5-7-17(15,16)8-9/h9-10H,4-8H2,1-3H3,(H,13,14).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid?
2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid has a molecular weight of 262.37 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexanoic acid is sourced from PubChem (CID 54957939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).