About 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide
2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide (PubChem CID 54958395) has the molecular formula C13H25N3OS
and a molecular weight of 271.43 g/mol. Its IUPAC name is 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide.
Molecular Properties
| Compound Name | 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide |
| PubChem CID | 54958395 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NC1=NC(CC(C)C)CS1 |
| InChI | InChI=1S/C13H25N3OS/c1-5-6-14-12(17)10(4)15-13-16-11(8-18-13)7-9(2)3/h9-11H,5-8H2,1-4H3,(H,14,17)(H,15,16) |
| InChIKey | BQGULSLAIFIJBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide?
The IUPAC name of 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide (CID 54958395) is 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide.
What is the SMILES notation for 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide?
The canonical SMILES for 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide is CCCNC(=O)C(C)NC1=NC(CC(C)C)CS1.
What is the InChIKey of 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide?
The InChIKey is BQGULSLAIFIJBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3OS/c1-5-6-14-12(17)10(4)15-13-16-11(8-18-13)7-9(2)3/h9-11H,5-8H2,1-4H3,(H,14,17)(H,15,16).
What are the key properties of 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide?
2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide has a molecular weight of 271.43 g/mol, XLogP of 2.01, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]-N-propylpropanamide is sourced from PubChem (CID 54958395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).