About 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile
4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 5496048) has the molecular formula C7H5N5
and a molecular weight of 159.15 g/mol. Its IUPAC name is 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| PubChem CID | 5496048 |
| Molecular Formula | C7H5N5 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c[nH]c2ncnc(N)c12 |
| InChI | InChI=1S/C7H5N5/c8-1-4-2-10-7-5(4)6(9)11-3-12-7/h2-3H,(H3,9,10,11,12) |
| InChIKey | GFIPINBJCGELKW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile?
The IUPAC name of 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile (CID 5496048) is 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile?
The canonical SMILES for 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile is N#Cc1c[nH]c2ncnc(N)c12.
What is the InChIKey of 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile?
The InChIKey is GFIPINBJCGELKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5/c8-1-4-2-10-7-5(4)6(9)11-3-12-7/h2-3H,(H3,9,10,11,12).
What are the key properties of 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile?
4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile has a molecular weight of 159.15 g/mol, XLogP of 0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile is sourced from PubChem (CID 5496048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).