C14H19N3 — CID 54960830
N-(3-imidazol-1-ylpropyl)-2,5-dimethylaniline (PubChem CID 54960830) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2,5-dimethylaniline.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2,5-dimethylaniline |
|---|---|
| PubChem CID | 54960830 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2,5-dimethylaniline |
| SMILES | Cc1ccc(C)c(NCCCn2ccnc2)c1 |
| InChI | InChI=1S/C14H19N3/c1-12-4-5-13(2)14(10-12)16-6-3-8-17-9-7-15-11-17/h4-5,7,9-11,16H,3,6,8H2,1-2H3 |
| InChIKey | YHUFJEBYGOFZFL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|