C11H23F3N2O — CID 54961645
N,N,2,2-tetramethyl-N'-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,3-diamine (PubChem CID 54961645) has the molecular formula C11H23F3N2O and a molecular weight of 256.31 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-N'-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,3-diamine.
| Compound Name | N,N,2,2-tetramethyl-N'-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 54961645 |
| Molecular Formula | C11H23F3N2O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N,N,2,2-tetramethyl-N'-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,3-diamine |
| SMILES | CN(C)CC(C)(C)CNCCOCC(F)(F)F |
| InChI | InChI=1S/C11H23F3N2O/c1-10(2,8-16(3)4)7-15-5-6-17-9-11(12,13)14/h15H,5-9H2,1-4H3 |
| InChIKey | WCKFSBBWYWNTGT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|