About 3-butan-2-yl-2,3-dihydrofuran
3-butan-2-yl-2,3-dihydrofuran (PubChem CID 549617) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 3-butan-2-yl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 3-butan-2-yl-2,3-dihydrofuran |
| PubChem CID | 549617 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 3-butan-2-yl-2,3-dihydrofuran |
| SMILES | CCC(C)C1C=COC1 |
| InChI | InChI=1S/C8H14O/c1-3-7(2)8-4-5-9-6-8/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | ZFHLYRXUGVHBRR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-butan-2-yl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-2,3-dihydrofuran?
The IUPAC name of 3-butan-2-yl-2,3-dihydrofuran (CID 549617) is 3-butan-2-yl-2,3-dihydrofuran.
What is the SMILES notation for 3-butan-2-yl-2,3-dihydrofuran?
The canonical SMILES for 3-butan-2-yl-2,3-dihydrofuran is CCC(C)C1C=COC1.
What is the InChIKey of 3-butan-2-yl-2,3-dihydrofuran?
The InChIKey is ZFHLYRXUGVHBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O/c1-3-7(2)8-4-5-9-6-8/h4-5,7-8H,3,6H2,1-2H3.
What are the key properties of 3-butan-2-yl-2,3-dihydrofuran?
3-butan-2-yl-2,3-dihydrofuran has a molecular weight of 126.20 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-2,3-dihydrofuran is sourced from PubChem (CID 549617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).