C10H18F3NO3S — CID 54961920
1,1-dioxo-N-[3-(2,2,2-trifluoroethoxy)propyl]thian-4-amine (PubChem CID 54961920) has the molecular formula C10H18F3NO3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 1,1-dioxo-N-[3-(2,2,2-trifluoroethoxy)propyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[3-(2,2,2-trifluoroethoxy)propyl]thian-4-amine |
|---|---|
| PubChem CID | 54961920 |
| Molecular Formula | C10H18F3NO3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1,1-dioxo-N-[3-(2,2,2-trifluoroethoxy)propyl]thian-4-amine |
| SMILES | O=S1(=O)CCC(NCCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3NO3S/c11-10(12,13)8-17-5-1-4-14-9-2-6-18(15,16)7-3-9/h9,14H,1-8H2 |
| InChIKey | KCDJVLSEIFMGTE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|