C12H16F3NOS — CID 54961957
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 54961957) has the molecular formula C12H16F3NOS and a molecular weight of 279.33 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 54961957 |
| Molecular Formula | C12H16F3NOS |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)(F)COCCNCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C12H16F3NOS/c13-12(14,15)8-17-5-4-16-7-10-6-9-2-1-3-11(9)18-10/h6,16H,1-5,7-8H2 |
| InChIKey | GVQXLOVQLXDAJM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|