C9H13F3N2OS2 — CID 54962028
4-methyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,3-thiazol-2-amine (PubChem CID 54962028) has the molecular formula C9H13F3N2OS2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 4-methyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 54962028 |
| Molecular Formula | C9H13F3N2OS2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-methyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1SCCCOCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2OS2/c1-6-7(17-8(13)14-6)16-4-2-3-15-5-9(10,11)12/h2-5H2,1H3,(H2,13,14) |
| InChIKey | GFDIXNFBSNPCKW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|