C11H13ClF3NOS — CID 54962029
5-chloro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline (PubChem CID 54962029) has the molecular formula C11H13ClF3NOS and a molecular weight of 299.75 g/mol. Its IUPAC name is 5-chloro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline.
| Compound Name | 5-chloro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline |
|---|---|
| PubChem CID | 54962029 |
| Molecular Formula | C11H13ClF3NOS |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 5-chloro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline |
| SMILES | Nc1cc(Cl)ccc1SCCCOCC(F)(F)F |
| InChI | InChI=1S/C11H13ClF3NOS/c12-8-2-3-10(9(16)6-8)18-5-1-4-17-7-11(13,14)15/h2-3,6H,1,4-5,7,16H2 |
| InChIKey | NDYDAPTYQWMNFF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|