About 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline
5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline (PubChem CID 54962136) has the molecular formula C11H13F4NOS
and a molecular weight of 283.29 g/mol. Its IUPAC name is 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline.
Molecular Properties
| Compound Name | 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline |
| PubChem CID | 54962136 |
| Molecular Formula | C11H13F4NOS |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline |
| SMILES | Nc1cc(F)ccc1SCCCOCC(F)(F)F |
| InChI | InChI=1S/C11H13F4NOS/c12-8-2-3-10(9(16)6-8)18-5-1-4-17-7-11(13,14)15/h2-3,6H,1,4-5,7,16H2 |
| InChIKey | CCSNOZMUSKLHEG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline?
The IUPAC name of 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline (CID 54962136) is 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline.
What is the SMILES notation for 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline?
The canonical SMILES for 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline is Nc1cc(F)ccc1SCCCOCC(F)(F)F.
What is the InChIKey of 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline?
The InChIKey is CCSNOZMUSKLHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F4NOS/c12-8-2-3-10(9(16)6-8)18-5-1-4-17-7-11(13,14)15/h2-3,6H,1,4-5,7,16H2.
What are the key properties of 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline?
5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline has a molecular weight of 283.29 g/mol, XLogP of 3.47, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline is sourced from PubChem (CID 54962136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).