C12H23F3N2O — CID 54962210
N'-cyclopentyl-N'-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,3-diamine (PubChem CID 54962210) has the molecular formula C12H23F3N2O and a molecular weight of 268.32 g/mol. Its IUPAC name is N'-cyclopentyl-N'-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,3-diamine.
| Compound Name | N'-cyclopentyl-N'-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 54962210 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N'-cyclopentyl-N'-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,3-diamine |
| SMILES | NCCCN(CCOCC(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C12H23F3N2O/c13-12(14,15)10-18-9-8-17(7-3-6-16)11-4-1-2-5-11/h11H,1-10,16H2 |
| InChIKey | AKFUQGDFVHEIMG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|