C10H19F3N2O2 — CID 54962335
N,N-dimethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]propanamide (PubChem CID 54962335) has the molecular formula C10H19F3N2O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]propanamide.
| Compound Name | N,N-dimethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]propanamide |
|---|---|
| PubChem CID | 54962335 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N,N-dimethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]propanamide |
| SMILES | CC(NCCCOCC(F)(F)F)C(=O)N(C)C |
| InChI | InChI=1S/C10H19F3N2O2/c1-8(9(16)15(2)3)14-5-4-6-17-7-10(11,12)13/h8,14H,4-7H2,1-3H3 |
| InChIKey | JYFGYWSZAVPDCB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|