About 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid
4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid (PubChem CID 54962520) has the molecular formula C10H13N3O4S
and a molecular weight of 271.30 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid |
| PubChem CID | 54962520 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid |
| SMILES | Cc1ncc(CNC(=O)NC(=O)CCC(=O)O)s1 |
| InChI | InChI=1S/C10H13N3O4S/c1-6-11-4-7(18-6)5-12-10(17)13-8(14)2-3-9(15)16/h4H,2-3,5H2,1H3,(H,15,16)(H2,12,13,14,17) |
| InChIKey | JZUBINMAFJAJAW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid?
The IUPAC name of 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid (CID 54962520) is 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid?
The canonical SMILES for 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid is Cc1ncc(CNC(=O)NC(=O)CCC(=O)O)s1.
What is the InChIKey of 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid?
The InChIKey is JZUBINMAFJAJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O4S/c1-6-11-4-7(18-6)5-12-10(17)13-8(14)2-3-9(15)16/h4H,2-3,5H2,1H3,(H,15,16)(H2,12,13,14,17).
What are the key properties of 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid?
4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid has a molecular weight of 271.30 g/mol, XLogP of 0.64, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]-4-oxobutanoic acid is sourced from PubChem (CID 54962520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).