C10H11N3O3S — CID 54962558
1-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4,5-trione (PubChem CID 54962558) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 1-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 54962558 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 1-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4,5-trione |
| SMILES | Cc1nc(C)c(C(C)N2C(=O)NC(=O)C2=O)s1 |
| InChI | InChI=1S/C10H11N3O3S/c1-4-7(17-6(3)11-4)5(2)13-9(15)8(14)12-10(13)16/h5H,1-3H3,(H,12,14,16) |
| InChIKey | IIOLUTWONYKYIS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|