C11H10N4S3 — CID 54963992
4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 54963992) has the molecular formula C11H10N4S3 and a molecular weight of 294.43 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 54963992 |
| Molecular Formula | C11H10N4S3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nc(Cn2c(-c3cccs3)n[nH]c2=S)cs1 |
| InChI | InChI=1S/C11H10N4S3/c1-7-12-8(6-18-7)5-15-10(13-14-11(15)16)9-3-2-4-17-9/h2-4,6H,5H2,1H3,(H,14,16) |
| InChIKey | JPUHDKKQSGSTLE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|